C30H31N3O5 — CID 3706628
2-(2,3-dihydro-1H-inden-2-yl)-1-[2-[5-(2-nitrophenyl)furan-2-carbonyl]-2,8-diazaspiro[4.5]decan-8-yl]ethanone (PubChem CID 3706628) has the molecular formula C30H31N3O5 and a molecular weight of 513.59 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-2-yl)-1-[2-[5-(2-nitrophenyl)furan-2-carbonyl]-2,8-diazaspiro[4.5]decan-8-yl]ethanone.
| Compound Name | 2-(2,3-dihydro-1H-inden-2-yl)-1-[2-[5-(2-nitrophenyl)furan-2-carbonyl]-2,8-diazaspiro[4.5]decan-8-yl]ethanone |
|---|---|
| PubChem CID | 3706628 |
| Molecular Formula | C30H31N3O5 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-2-yl)-1-[2-[5-(2-nitrophenyl)furan-2-carbonyl]-2,8-diazaspiro[4.5]decan-8-yl]ethanone |
| SMILES | O=C(CC1Cc2ccccc2C1)N1CCC2(CC1)CCN(C(=O)c1ccc(-c3ccccc3[N+](=O)[O-])o1)C2 |
| InChI | InChI=1S/C30H31N3O5/c34-28(19-21-17-22-5-1-2-6-23(22)18-21)31-14-11-30(12-15-31)13-16-32(20-30)29(35)27-10-9-26(38-27)24-7-3-4-8-25(24)33(36)37/h1-10,21H,11-20H2 |
| InChIKey | WYIFTZTYTMCBKX-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 96.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|