C27H29N3O6S — CID 4637625
[8-(2,5-dimethylphenyl)sulfonyl-2,8-diazaspiro[4.5]decan-2-yl]-[5-(2-nitrophenyl)furan-2-yl]methanone (PubChem CID 4637625) has the molecular formula C27H29N3O6S and a molecular weight of 523.61 g/mol. Its IUPAC name is [8-(2,5-dimethylphenyl)sulfonyl-2,8-diazaspiro[4.5]decan-2-yl]-[5-(2-nitrophenyl)furan-2-yl]methanone.
| Compound Name | [8-(2,5-dimethylphenyl)sulfonyl-2,8-diazaspiro[4.5]decan-2-yl]-[5-(2-nitrophenyl)furan-2-yl]methanone |
|---|---|
| PubChem CID | 4637625 |
| Molecular Formula | C27H29N3O6S |
| Molecular Weight | 523.61 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | [8-(2,5-dimethylphenyl)sulfonyl-2,8-diazaspiro[4.5]decan-2-yl]-[5-(2-nitrophenyl)furan-2-yl]methanone |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCC3(CCN(C(=O)c4ccc(-c5ccccc5[N+](=O)[O-])o4)C3)CC2)c1 |
| InChI | InChI=1S/C27H29N3O6S/c1-19-7-8-20(2)25(17-19)37(34,35)29-15-12-27(13-16-29)11-14-28(18-27)26(31)24-10-9-23(36-24)21-5-3-4-6-22(21)30(32)33/h3-10,17H,11-16,18H2,1-2H3 |
| InChIKey | XXZUIOOAXFHCBD-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 113.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.61 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|