C27H31N3O2S — CID 3539077
8-(4-acetylbenzoyl)-N-(2,3-dihydro-1H-inden-2-yl)-2,8-diazaspiro[4.5]decane-2-carbothioamide (PubChem CID 3539077) has the molecular formula C27H31N3O2S and a molecular weight of 461.63 g/mol. Its IUPAC name is 8-(4-acetylbenzoyl)-N-(2,3-dihydro-1H-inden-2-yl)-2,8-diazaspiro[4.5]decane-2-carbothioamide.
| Compound Name | 8-(4-acetylbenzoyl)-N-(2,3-dihydro-1H-inden-2-yl)-2,8-diazaspiro[4.5]decane-2-carbothioamide |
|---|---|
| PubChem CID | 3539077 |
| Molecular Formula | C27H31N3O2S |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 8-(4-acetylbenzoyl)-N-(2,3-dihydro-1H-inden-2-yl)-2,8-diazaspiro[4.5]decane-2-carbothioamide |
| SMILES | CC(=O)c1ccc(C(=O)N2CCC3(CC2)CCN(C(=S)NC2Cc4ccccc4C2)C3)cc1 |
| InChI | InChI=1S/C27H31N3O2S/c1-19(31)20-6-8-21(9-7-20)25(32)29-13-10-27(11-14-29)12-15-30(18-27)26(33)28-24-16-22-4-2-3-5-23(22)17-24/h2-9,24H,10-18H2,1H3,(H,28,33) |
| InChIKey | PSZMILCZQWXRFH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|