C22H30N2O5 — CID 3600409
1-[8-(4-acetylbenzoyl)-2,8-diazaspiro[4.5]decan-2-yl]-2-(2-methoxyethoxy)ethanone (PubChem CID 3600409) has the molecular formula C22H30N2O5 and a molecular weight of 402.49 g/mol. Its IUPAC name is 1-[8-(4-acetylbenzoyl)-2,8-diazaspiro[4.5]decan-2-yl]-2-(2-methoxyethoxy)ethanone.
| Compound Name | 1-[8-(4-acetylbenzoyl)-2,8-diazaspiro[4.5]decan-2-yl]-2-(2-methoxyethoxy)ethanone |
|---|---|
| PubChem CID | 3600409 |
| Molecular Formula | C22H30N2O5 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 1-[8-(4-acetylbenzoyl)-2,8-diazaspiro[4.5]decan-2-yl]-2-(2-methoxyethoxy)ethanone |
| SMILES | COCCOCC(=O)N1CCC2(CCN(C(=O)c3ccc(C(C)=O)cc3)CC2)C1 |
| InChI | InChI=1S/C22H30N2O5/c1-17(25)18-3-5-19(6-4-18)21(27)23-10-7-22(8-11-23)9-12-24(16-22)20(26)15-29-14-13-28-2/h3-6H,7-16H2,1-2H3 |
| InChIKey | HBIORGSBSCKUIR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|