C20H28ClN3O5 — CID 4995127
1-[8-(2-chloro-6-methoxypyridine-4-carbonyl)-2,8-diazaspiro[4.5]decan-2-yl]-2-(2-methoxyethoxy)ethanone (PubChem CID 4995127) has the molecular formula C20H28ClN3O5 and a molecular weight of 425.91 g/mol. Its IUPAC name is 1-[8-(2-chloro-6-methoxypyridine-4-carbonyl)-2,8-diazaspiro[4.5]decan-2-yl]-2-(2-methoxyethoxy)ethanone.
| Compound Name | 1-[8-(2-chloro-6-methoxypyridine-4-carbonyl)-2,8-diazaspiro[4.5]decan-2-yl]-2-(2-methoxyethoxy)ethanone |
|---|---|
| PubChem CID | 4995127 |
| Molecular Formula | C20H28ClN3O5 |
| Molecular Weight | 425.91 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 1-[8-(2-chloro-6-methoxypyridine-4-carbonyl)-2,8-diazaspiro[4.5]decan-2-yl]-2-(2-methoxyethoxy)ethanone |
| SMILES | COCCOCC(=O)N1CCC2(CCN(C(=O)c3cc(Cl)nc(OC)c3)CC2)C1 |
| InChI | InChI=1S/C20H28ClN3O5/c1-27-9-10-29-13-18(25)24-8-5-20(14-24)3-6-23(7-4-20)19(26)15-11-16(21)22-17(12-15)28-2/h11-12H,3-10,13-14H2,1-2H3 |
| InChIKey | NMXIIHJCRCCCPX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 81.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.91 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|