C21H28ClN3O4S — CID 74228153
S-[(2S)-3-[8-(2-chloro-6-methoxypyridine-4-carbonyl)-2,8-diazaspiro[4.5]decan-2-yl]-2-methyl-3-oxopropyl] ethanethioate (PubChem CID 74228153) has the molecular formula C21H28ClN3O4S and a molecular weight of 453.99 g/mol. Its IUPAC name is S-[(2S)-3-[8-(2-chloro-6-methoxypyridine-4-carbonyl)-2,8-diazaspiro[4.5]decan-2-yl]-2-methyl-3-oxopropyl] ethanethioate.
| Compound Name | S-[(2S)-3-[8-(2-chloro-6-methoxypyridine-4-carbonyl)-2,8-diazaspiro[4.5]decan-2-yl]-2-methyl-3-oxopropyl] ethanethioate |
|---|---|
| PubChem CID | 74228153 |
| Molecular Formula | C21H28ClN3O4S |
| Molecular Weight | 453.99 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | S-[(2S)-3-[8-(2-chloro-6-methoxypyridine-4-carbonyl)-2,8-diazaspiro[4.5]decan-2-yl]-2-methyl-3-oxopropyl] ethanethioate |
| SMILES | COc1cc(C(=O)N2CCC3(CC2)CCN(C(=O)[C@H](C)CSC(C)=O)C3)cc(Cl)n1 |
| InChI | InChI=1S/C21H28ClN3O4S/c1-14(12-30-15(2)26)19(27)25-9-6-21(13-25)4-7-24(8-5-21)20(28)16-10-17(22)23-18(11-16)29-3/h10-11,14H,4-9,12-13H2,1-3H3/t14-/m1/s1 |
| InChIKey | CLKAXAQAYMMYNQ-CQSZACIVSA-N |
| XLogP | 3.11 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.99 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|