C30H26ClN3O5 — CID 3867564
2-[8-(2-chloro-6-methoxypyridine-4-carbonyl)-2,8-diazaspiro[4.5]decane-2-carbonyl]anthracene-9,10-dione (PubChem CID 3867564) has the molecular formula C30H26ClN3O5 and a molecular weight of 544.01 g/mol. Its IUPAC name is 2-[8-(2-chloro-6-methoxypyridine-4-carbonyl)-2,8-diazaspiro[4.5]decane-2-carbonyl]anthracene-9,10-dione.
| Compound Name | 2-[8-(2-chloro-6-methoxypyridine-4-carbonyl)-2,8-diazaspiro[4.5]decane-2-carbonyl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 3867564 |
| Molecular Formula | C30H26ClN3O5 |
| Molecular Weight | 544.01 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | 2-[8-(2-chloro-6-methoxypyridine-4-carbonyl)-2,8-diazaspiro[4.5]decane-2-carbonyl]anthracene-9,10-dione |
| SMILES | COc1cc(C(=O)N2CCC3(CC2)CCN(C(=O)c2ccc4c(c2)C(=O)c2ccccc2C4=O)C3)cc(Cl)n1 |
| InChI | InChI=1S/C30H26ClN3O5/c1-39-25-16-19(15-24(31)32-25)29(38)33-11-8-30(9-12-33)10-13-34(17-30)28(37)18-6-7-22-23(14-18)27(36)21-5-3-2-4-20(21)26(22)35/h2-7,14-16H,8-13,17H2,1H3 |
| InChIKey | KUTRRZUZNVNMQK-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 96.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.01 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|