C24H28ClN3O4S — CID 3729625
1-[8-(2-chloro-6-methoxypyridine-4-carbonyl)-2,8-diazaspiro[4.5]decan-2-yl]-5-thiophen-2-ylpentane-1,5-dione (PubChem CID 3729625) has the molecular formula C24H28ClN3O4S and a molecular weight of 490.03 g/mol. Its IUPAC name is 1-[8-(2-chloro-6-methoxypyridine-4-carbonyl)-2,8-diazaspiro[4.5]decan-2-yl]-5-thiophen-2-ylpentane-1,5-dione.
| Compound Name | 1-[8-(2-chloro-6-methoxypyridine-4-carbonyl)-2,8-diazaspiro[4.5]decan-2-yl]-5-thiophen-2-ylpentane-1,5-dione |
|---|---|
| PubChem CID | 3729625 |
| Molecular Formula | C24H28ClN3O4S |
| Molecular Weight | 490.03 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | 1-[8-(2-chloro-6-methoxypyridine-4-carbonyl)-2,8-diazaspiro[4.5]decan-2-yl]-5-thiophen-2-ylpentane-1,5-dione |
| SMILES | COc1cc(C(=O)N2CCC3(CCN(C(=O)CCCC(=O)c4cccs4)C3)CC2)cc(Cl)n1 |
| InChI | InChI=1S/C24H28ClN3O4S/c1-32-21-15-17(14-20(25)26-21)23(31)27-10-7-24(8-11-27)9-12-28(16-24)22(30)6-2-4-18(29)19-5-3-13-33-19/h3,5,13-15H,2,4,6-12,16H2,1H3 |
| InChIKey | XTHCLEXVFWBULG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.03 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|