C20H28N2O3S — CID 3857079
1-(4-methoxyphenoxy)-3-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]propan-2-ol (PubChem CID 3857079) has the molecular formula C20H28N2O3S and a molecular weight of 376.52 g/mol. Its IUPAC name is 1-(4-methoxyphenoxy)-3-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]propan-2-ol.
| Compound Name | 1-(4-methoxyphenoxy)-3-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 3857079 |
| Molecular Formula | C20H28N2O3S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 1-(4-methoxyphenoxy)-3-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]propan-2-ol |
| SMILES | COc1ccc(OCC(O)CN2CCN(CCc3cccs3)CC2)cc1 |
| InChI | InChI=1S/C20H28N2O3S/c1-24-18-4-6-19(7-5-18)25-16-17(23)15-22-12-10-21(11-13-22)9-8-20-3-2-14-26-20/h2-7,14,17,23H,8-13,15-16H2,1H3 |
| InChIKey | LZWZUOALECNKRE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |