C17H28N2O4 — CID 3857124
5,5-dimethyl-3-[1-(3-prop-2-enoxypropanoyl)piperidin-4-yl]-1,3-oxazinan-2-one (PubChem CID 3857124) has the molecular formula C17H28N2O4 and a molecular weight of 324.42 g/mol. Its IUPAC name is 5,5-dimethyl-3-[1-(3-prop-2-enoxypropanoyl)piperidin-4-yl]-1,3-oxazinan-2-one.
| Compound Name | 5,5-dimethyl-3-[1-(3-prop-2-enoxypropanoyl)piperidin-4-yl]-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 3857124 |
| Molecular Formula | C17H28N2O4 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 5,5-dimethyl-3-[1-(3-prop-2-enoxypropanoyl)piperidin-4-yl]-1,3-oxazinan-2-one |
| SMILES | C=CCOCCC(=O)N1CCC(N2CC(C)(C)COC2=O)CC1 |
| InChI | InChI=1S/C17H28N2O4/c1-4-10-22-11-7-15(20)18-8-5-14(6-9-18)19-12-17(2,3)13-23-16(19)21/h4,14H,1,5-13H2,2-3H3 |
| InChIKey | AZUGYPCWWSTZAO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|