C14H9ClN4S — CID 3859169
2-(5-chlorothiophen-2-yl)imidazo[2,1-a]phthalazin-6-amine (PubChem CID 3859169) has the molecular formula C14H9ClN4S and a molecular weight of 300.77 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)imidazo[2,1-a]phthalazin-6-amine.
| Compound Name | 2-(5-chlorothiophen-2-yl)imidazo[2,1-a]phthalazin-6-amine |
|---|---|
| PubChem CID | 3859169 |
| Molecular Formula | C14H9ClN4S |
| Molecular Weight | 300.77 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)imidazo[2,1-a]phthalazin-6-amine |
| SMILES | Nc1nn2cc(-c3ccc(Cl)s3)nc2c2ccccc12 |
| InChI | InChI=1S/C14H9ClN4S/c15-12-6-5-11(20-12)10-7-19-14(17-10)9-4-2-1-3-8(9)13(16)18-19/h1-7H,(H2,16,18) |
| InChIKey | ZJKMPHYUVJSMLJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.77 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |