C20H17FN2O2S — CID 38614359
N-[3-[(3-fluorophenoxy)methyl]phenyl]-2-methylsulfanylpyridine-3-carboxamide (PubChem CID 38614359) has the molecular formula C20H17FN2O2S and a molecular weight of 368.43 g/mol. Its IUPAC name is N-[3-[(3-fluorophenoxy)methyl]phenyl]-2-methylsulfanylpyridine-3-carboxamide.
| Compound Name | N-[3-[(3-fluorophenoxy)methyl]phenyl]-2-methylsulfanylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 38614359 |
| Molecular Formula | C20H17FN2O2S |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | N-[3-[(3-fluorophenoxy)methyl]phenyl]-2-methylsulfanylpyridine-3-carboxamide |
| SMILES | CSc1ncccc1C(=O)Nc1cccc(COc2cccc(F)c2)c1 |
| InChI | InChI=1S/C20H17FN2O2S/c1-26-20-18(9-4-10-22-20)19(24)23-16-7-2-5-14(11-16)13-25-17-8-3-6-15(21)12-17/h2-12H,13H2,1H3,(H,23,24) |
| InChIKey | ICYHZGHXQIOQHF-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |