C24H22FNO6 — CID 55778127
methyl 2-[4-[[3-[(3-fluorophenoxy)methyl]phenyl]carbamoyl]-2-methoxyphenoxy]acetate (PubChem CID 55778127) has the molecular formula C24H22FNO6 and a molecular weight of 439.44 g/mol. Its IUPAC name is methyl 2-[4-[[3-[(3-fluorophenoxy)methyl]phenyl]carbamoyl]-2-methoxyphenoxy]acetate.
| Compound Name | methyl 2-[4-[[3-[(3-fluorophenoxy)methyl]phenyl]carbamoyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 55778127 |
| Molecular Formula | C24H22FNO6 |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | methyl 2-[4-[[3-[(3-fluorophenoxy)methyl]phenyl]carbamoyl]-2-methoxyphenoxy]acetate |
| SMILES | COC(=O)COc1ccc(C(=O)Nc2cccc(COc3cccc(F)c3)c2)cc1OC |
| InChI | InChI=1S/C24H22FNO6/c1-29-22-12-17(9-10-21(22)32-15-23(27)30-2)24(28)26-19-7-3-5-16(11-19)14-31-20-8-4-6-18(25)13-20/h3-13H,14-15H2,1-2H3,(H,26,28) |
| InChIKey | NZMMIVODHHCUCN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |