C23H17FN2O3 — CID 55836607
N-[3-[(3-fluorophenoxy)methyl]phenyl]-4-(1,3-oxazol-5-yl)benzamide (PubChem CID 55836607) has the molecular formula C23H17FN2O3 and a molecular weight of 388.40 g/mol. Its IUPAC name is N-[3-[(3-fluorophenoxy)methyl]phenyl]-4-(1,3-oxazol-5-yl)benzamide.
| Compound Name | N-[3-[(3-fluorophenoxy)methyl]phenyl]-4-(1,3-oxazol-5-yl)benzamide |
|---|---|
| PubChem CID | 55836607 |
| Molecular Formula | C23H17FN2O3 |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | N-[3-[(3-fluorophenoxy)methyl]phenyl]-4-(1,3-oxazol-5-yl)benzamide |
| SMILES | O=C(Nc1cccc(COc2cccc(F)c2)c1)c1ccc(-c2cnco2)cc1 |
| InChI | InChI=1S/C23H17FN2O3/c24-19-4-2-6-21(12-19)28-14-16-3-1-5-20(11-16)26-23(27)18-9-7-17(8-10-18)22-13-25-15-29-22/h1-13,15H,14H2,(H,26,27) |
| InChIKey | DGWIAHAUDQSAOO-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |