C17H12F3N3O3 — CID 55836609
4-(1,3-oxazol-5-yl)-N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]benzamide (PubChem CID 55836609) has the molecular formula C17H12F3N3O3 and a molecular weight of 363.30 g/mol. Its IUPAC name is 4-(1,3-oxazol-5-yl)-N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]benzamide.
| Compound Name | 4-(1,3-oxazol-5-yl)-N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 55836609 |
| Molecular Formula | C17H12F3N3O3 |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 4-(1,3-oxazol-5-yl)-N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]benzamide |
| SMILES | O=C(Nc1ccc(OCC(F)(F)F)nc1)c1ccc(-c2cnco2)cc1 |
| InChI | InChI=1S/C17H12F3N3O3/c18-17(19,20)9-25-15-6-5-13(7-22-15)23-16(24)12-3-1-11(2-4-12)14-8-21-10-26-14/h1-8,10H,9H2,(H,23,24) |
| InChIKey | MEUBMYYOHFDTLU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |