C10H7FN2O2 — CID 96596303
N-(3-fluorophenyl)-1,3-oxazole-5-carboxamide (PubChem CID 96596303) has the molecular formula C10H7FN2O2 and a molecular weight of 206.18 g/mol. Its IUPAC name is N-(3-fluorophenyl)-1,3-oxazole-5-carboxamide.
| Compound Name | N-(3-fluorophenyl)-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 96596303 |
| Molecular Formula | C10H7FN2O2 |
| Molecular Weight | 206.18 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | N-(3-fluorophenyl)-1,3-oxazole-5-carboxamide |
| SMILES | O=C(Nc1cccc(F)c1)c1cnco1 |
| InChI | InChI=1S/C10H7FN2O2/c11-7-2-1-3-8(4-7)13-10(14)9-5-12-6-15-9/h1-6H,(H,13,14) |
| InChIKey | HZPQSULUWRFZQZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.18 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |