C10H7F5N2O2S — CID 122482945
N-[4-(pentafluoro-λ6-sulfanyl)phenyl]-1,3-oxazole-5-carboxamide (PubChem CID 122482945) has the molecular formula C10H7F5N2O2S and a molecular weight of 314.24 g/mol. Its IUPAC name is N-[4-(pentafluoro-λ6-sulfanyl)phenyl]-1,3-oxazole-5-carboxamide.
| Compound Name | N-[4-(pentafluoro-λ6-sulfanyl)phenyl]-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 122482945 |
| Molecular Formula | C10H7F5N2O2S |
| Molecular Weight | 314.24 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | N-[4-(pentafluoro-λ6-sulfanyl)phenyl]-1,3-oxazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(S(F)(F)(F)(F)F)cc1)c1cnco1 |
| InChI | InChI=1S/C10H7F5N2O2S/c11-20(12,13,14,15)8-3-1-7(2-4-8)17-10(18)9-5-16-6-19-9/h1-6H,(H,17,18) |
| InChIKey | IWWBUNPATUDOCR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.24 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |