C12H12N2O2 — CID 96586898
N-[(1R)-1-phenylethyl]-1,3-oxazole-5-carboxamide (PubChem CID 96586898) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is N-[(1R)-1-phenylethyl]-1,3-oxazole-5-carboxamide.
| Compound Name | N-[(1R)-1-phenylethyl]-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 96586898 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | N-[(1R)-1-phenylethyl]-1,3-oxazole-5-carboxamide |
| SMILES | C[C@@H](NC(=O)c1cnco1)c1ccccc1 |
| InChI | InChI=1S/C12H12N2O2/c1-9(10-5-3-2-4-6-10)14-12(15)11-7-13-8-16-11/h2-9H,1H3,(H,14,15)/t9-/m1/s1 |
| InChIKey | YPMQQHCCLPFZID-SECBINFHSA-N |
| XLogP | 2.17 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |