C20H18N2O2S2 — CID 38629863
4-[2-[[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]methylsulfanyl]ethoxy]benzonitrile (PubChem CID 38629863) has the molecular formula C20H18N2O2S2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 4-[2-[[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]methylsulfanyl]ethoxy]benzonitrile.
| Compound Name | 4-[2-[[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]methylsulfanyl]ethoxy]benzonitrile |
|---|---|
| PubChem CID | 38629863 |
| Molecular Formula | C20H18N2O2S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 4-[2-[[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]methylsulfanyl]ethoxy]benzonitrile |
| SMILES | COc1ccc(-c2nc(CSCCOc3ccc(C#N)cc3)cs2)cc1 |
| InChI | InChI=1S/C20H18N2O2S2/c1-23-18-8-4-16(5-9-18)20-22-17(14-26-20)13-25-11-10-24-19-6-2-15(12-21)3-7-19/h2-9,14H,10-11,13H2,1H3 |
| InChIKey | BARRVLVARCPBMU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|