C18H21N5O3 — CID 38645394
1-(3-aminopyrazine-2-carbonyl)-N-(2-methoxyphenyl)piperidine-4-carboxamide (PubChem CID 38645394) has the molecular formula C18H21N5O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is 1-(3-aminopyrazine-2-carbonyl)-N-(2-methoxyphenyl)piperidine-4-carboxamide.
| Compound Name | 1-(3-aminopyrazine-2-carbonyl)-N-(2-methoxyphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 38645394 |
| Molecular Formula | C18H21N5O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 1-(3-aminopyrazine-2-carbonyl)-N-(2-methoxyphenyl)piperidine-4-carboxamide |
| SMILES | COc1ccccc1NC(=O)C1CCN(C(=O)c2nccnc2N)CC1 |
| InChI | InChI=1S/C18H21N5O3/c1-26-14-5-3-2-4-13(14)22-17(24)12-6-10-23(11-7-12)18(25)15-16(19)21-9-8-20-15/h2-5,8-9,12H,6-7,10-11H2,1H3,(H2,19,21)(H,22,24) |
| InChIKey | LYGDVHHJPJZSMD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |