C16H10BrCl2NO2S — CID 3865919
N-(4-bromonaphthalen-1-yl)-3,4-dichlorobenzenesulfonamide (PubChem CID 3865919) has the molecular formula C16H10BrCl2NO2S and a molecular weight of 431.14 g/mol. Its IUPAC name is N-(4-bromonaphthalen-1-yl)-3,4-dichlorobenzenesulfonamide.
| Compound Name | N-(4-bromonaphthalen-1-yl)-3,4-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 3865919 |
| Molecular Formula | C16H10BrCl2NO2S |
| Molecular Weight | 431.14 g/mol |
| Exact Mass | 428.90 |
| IUPAC Name | N-(4-bromonaphthalen-1-yl)-3,4-dichlorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Br)c2ccccc12)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H10BrCl2NO2S/c17-13-6-8-16(12-4-2-1-3-11(12)13)20-23(21,22)10-5-7-14(18)15(19)9-10/h1-9,20H |
| InChIKey | BVAOROXEBMAXJV-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.14 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |