C24H24ClN3O4S — CID 38659885
3-(benzylsulfamoyl)-N-[2-(2-chloroanilino)-2-oxoethyl]-N,4-dimethylbenzamide (PubChem CID 38659885) has the molecular formula C24H24ClN3O4S and a molecular weight of 485.99 g/mol. Its IUPAC name is 3-(benzylsulfamoyl)-N-[2-(2-chloroanilino)-2-oxoethyl]-N,4-dimethylbenzamide.
| Compound Name | 3-(benzylsulfamoyl)-N-[2-(2-chloroanilino)-2-oxoethyl]-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 38659885 |
| Molecular Formula | C24H24ClN3O4S |
| Molecular Weight | 485.99 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 3-(benzylsulfamoyl)-N-[2-(2-chloroanilino)-2-oxoethyl]-N,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)N(C)CC(=O)Nc2ccccc2Cl)cc1S(=O)(=O)NCc1ccccc1 |
| InChI | InChI=1S/C24H24ClN3O4S/c1-17-12-13-19(14-22(17)33(31,32)26-15-18-8-4-3-5-9-18)24(30)28(2)16-23(29)27-21-11-7-6-10-20(21)25/h3-14,26H,15-16H2,1-2H3,(H,27,29) |
| InChIKey | XFXOWCGIFQQLSD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.99 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |