C19H18N4O3S — CID 60613005
3-(benzylsulfamoyl)-N,N-bis(cyanomethyl)-4-methylbenzamide (PubChem CID 60613005) has the molecular formula C19H18N4O3S and a molecular weight of 382.45 g/mol. Its IUPAC name is 3-(benzylsulfamoyl)-N,N-bis(cyanomethyl)-4-methylbenzamide.
| Compound Name | 3-(benzylsulfamoyl)-N,N-bis(cyanomethyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 60613005 |
| Molecular Formula | C19H18N4O3S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 3-(benzylsulfamoyl)-N,N-bis(cyanomethyl)-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N(CC#N)CC#N)cc1S(=O)(=O)NCc1ccccc1 |
| InChI | InChI=1S/C19H18N4O3S/c1-15-7-8-17(19(24)23(11-9-20)12-10-21)13-18(15)27(25,26)22-14-16-5-3-2-4-6-16/h2-8,13,22H,11-12,14H2,1H3 |
| InChIKey | MPDBUEXYJVAUCJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|