C17H11ClF3N5O5 — CID 38665707
N-(2-chloro-5-nitrophenyl)-2-[1-methyl-2,4-dioxo-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-3-yl]acetamide (PubChem CID 38665707) has the molecular formula C17H11ClF3N5O5 and a molecular weight of 457.75 g/mol. Its IUPAC name is N-(2-chloro-5-nitrophenyl)-2-[1-methyl-2,4-dioxo-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-3-yl]acetamide.
| Compound Name | N-(2-chloro-5-nitrophenyl)-2-[1-methyl-2,4-dioxo-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-3-yl]acetamide |
|---|---|
| PubChem CID | 38665707 |
| Molecular Formula | C17H11ClF3N5O5 |
| Molecular Weight | 457.75 g/mol |
| Exact Mass | 457.04 |
| IUPAC Name | N-(2-chloro-5-nitrophenyl)-2-[1-methyl-2,4-dioxo-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-3-yl]acetamide |
| SMILES | Cn1c(=O)n(CC(=O)Nc2cc([N+](=O)[O-])ccc2Cl)c(=O)c2ccc(C(F)(F)F)nc21 |
| InChI | InChI=1S/C17H11ClF3N5O5/c1-24-14-9(3-5-12(23-14)17(19,20)21)15(28)25(16(24)29)7-13(27)22-11-6-8(26(30)31)2-4-10(11)18/h2-6H,7H2,1H3,(H,22,27) |
| InChIKey | IYQQDMKANTYUQU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 129.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.75 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|