C19H12ClF3N4O2 — CID 38666709
3-[(2-chloroquinolin-3-yl)methyl]-1-methyl-7-(trifluoromethyl)pyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 38666709) has the molecular formula C19H12ClF3N4O2 and a molecular weight of 420.78 g/mol. Its IUPAC name is 3-[(2-chloroquinolin-3-yl)methyl]-1-methyl-7-(trifluoromethyl)pyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 3-[(2-chloroquinolin-3-yl)methyl]-1-methyl-7-(trifluoromethyl)pyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 38666709 |
| Molecular Formula | C19H12ClF3N4O2 |
| Molecular Weight | 420.78 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | 3-[(2-chloroquinolin-3-yl)methyl]-1-methyl-7-(trifluoromethyl)pyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)n(Cc2cc3ccccc3nc2Cl)c(=O)c2ccc(C(F)(F)F)nc21 |
| InChI | InChI=1S/C19H12ClF3N4O2/c1-26-16-12(6-7-14(25-16)19(21,22)23)17(28)27(18(26)29)9-11-8-10-4-2-3-5-13(10)24-15(11)20/h2-8H,9H2,1H3 |
| InChIKey | CPHJNWXTNFUCID-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.78 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|