C15H9Cl2F3N4O2 — CID 75454825
3-[(3,6-dichloro-2-pyridinyl)methyl]-1-methyl-7-(trifluoromethyl)pyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 75454825) has the molecular formula C15H9Cl2F3N4O2 and a molecular weight of 405.16 g/mol. Its IUPAC name is 3-[(3,6-dichloro-2-pyridinyl)methyl]-1-methyl-7-(trifluoromethyl)pyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 3-[(3,6-dichloro-2-pyridinyl)methyl]-1-methyl-7-(trifluoromethyl)pyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 75454825 |
| Molecular Formula | C15H9Cl2F3N4O2 |
| Molecular Weight | 405.16 g/mol |
| Exact Mass | 404.01 |
| IUPAC Name | 3-[(3,6-dichloro-2-pyridinyl)methyl]-1-methyl-7-(trifluoromethyl)pyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)n(Cc2nc(Cl)ccc2Cl)c(=O)c2ccc(C(F)(F)F)nc21 |
| InChI | InChI=1S/C15H9Cl2F3N4O2/c1-23-12-7(2-4-10(22-12)15(18,19)20)13(25)24(14(23)26)6-9-8(16)3-5-11(17)21-9/h2-5H,6H2,1H3 |
| InChIKey | RGRMLGOLEOAEPK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.16 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|