C16H24N2O2S2 — CID 3867912
[2-[1-(2,6-dimethylphenoxy)propan-2-ylamino]-2-oxoethyl] N,N-dimethylcarbamodithioate (PubChem CID 3867912) has the molecular formula C16H24N2O2S2 and a molecular weight of 340.51 g/mol. Its IUPAC name is [2-[1-(2,6-dimethylphenoxy)propan-2-ylamino]-2-oxoethyl] N,N-dimethylcarbamodithioate.
| Compound Name | [2-[1-(2,6-dimethylphenoxy)propan-2-ylamino]-2-oxoethyl] N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 3867912 |
| Molecular Formula | C16H24N2O2S2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | [2-[1-(2,6-dimethylphenoxy)propan-2-ylamino]-2-oxoethyl] N,N-dimethylcarbamodithioate |
| SMILES | Cc1cccc(C)c1OCC(C)NC(=O)CSC(=S)N(C)C |
| InChI | InChI=1S/C16H24N2O2S2/c1-11-7-6-8-12(2)15(11)20-9-13(3)17-14(19)10-22-16(21)18(4)5/h6-8,13H,9-10H2,1-5H3,(H,17,19) |
| InChIKey | ZNVPHDHGEVDTJU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|