C14H22N4O2 — CID 57406196
2-(diaminomethylideneamino)-N-[1-(2,6-dimethylphenoxy)propan-2-yl]acetamide (PubChem CID 57406196) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 2-(diaminomethylideneamino)-N-[1-(2,6-dimethylphenoxy)propan-2-yl]acetamide.
| Compound Name | 2-(diaminomethylideneamino)-N-[1-(2,6-dimethylphenoxy)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 57406196 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 2-(diaminomethylideneamino)-N-[1-(2,6-dimethylphenoxy)propan-2-yl]acetamide |
| SMILES | Cc1cccc(C)c1OCC(C)NC(=O)CN=C(N)N |
| InChI | InChI=1S/C14H22N4O2/c1-9-5-4-6-10(2)13(9)20-8-11(3)18-12(19)7-17-14(15)16/h4-6,11H,7-8H2,1-3H3,(H,18,19)(H4,15,16,17) |
| InChIKey | MHUQAPXOQXLEHL-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|