C23H23F3N2O4 — CID 3869157
4-methyl-5-phenyl-3-[1-(2,4,5-trifluoro-3-methoxybenzoyl)piperidin-4-yl]-1,3-oxazolidin-2-one (PubChem CID 3869157) has the molecular formula C23H23F3N2O4 and a molecular weight of 448.44 g/mol. Its IUPAC name is 4-methyl-5-phenyl-3-[1-(2,4,5-trifluoro-3-methoxybenzoyl)piperidin-4-yl]-1,3-oxazolidin-2-one.
| Compound Name | 4-methyl-5-phenyl-3-[1-(2,4,5-trifluoro-3-methoxybenzoyl)piperidin-4-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 3869157 |
| Molecular Formula | C23H23F3N2O4 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 4-methyl-5-phenyl-3-[1-(2,4,5-trifluoro-3-methoxybenzoyl)piperidin-4-yl]-1,3-oxazolidin-2-one |
| SMILES | COc1c(F)c(F)cc(C(=O)N2CCC(N3C(=O)OC(c4ccccc4)C3C)CC2)c1F |
| InChI | InChI=1S/C23H23F3N2O4/c1-13-20(14-6-4-3-5-7-14)32-23(30)28(13)15-8-10-27(11-9-15)22(29)16-12-17(24)19(26)21(31-2)18(16)25/h3-7,12-13,15,20H,8-11H2,1-2H3 |
| InChIKey | MKGDINLZCAZQMA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|