C22H22N4O5S2 — CID 38699951
2-(2-benzyl-1,3-thiazol-4-yl)-1-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]ethanone (PubChem CID 38699951) has the molecular formula C22H22N4O5S2 and a molecular weight of 486.58 g/mol. Its IUPAC name is 2-(2-benzyl-1,3-thiazol-4-yl)-1-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]ethanone.
| Compound Name | 2-(2-benzyl-1,3-thiazol-4-yl)-1-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 38699951 |
| Molecular Formula | C22H22N4O5S2 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | 2-(2-benzyl-1,3-thiazol-4-yl)-1-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]ethanone |
| SMILES | O=C(Cc1csc(Cc2ccccc2)n1)N1CCN(S(=O)(=O)c2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C22H22N4O5S2/c27-22(14-18-16-32-21(23-18)13-17-5-2-1-3-6-17)24-9-11-25(12-10-24)33(30,31)20-8-4-7-19(15-20)26(28)29/h1-8,15-16H,9-14H2 |
| InChIKey | UAYQASRXQQTTNG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 113.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|