C22H23BrN2O2 — CID 3872632
2-(6-bromonaphthalen-2-yl)oxy-N-[4-(diethylamino)phenyl]acetamide (PubChem CID 3872632) has the molecular formula C22H23BrN2O2 and a molecular weight of 427.34 g/mol. Its IUPAC name is 2-(6-bromonaphthalen-2-yl)oxy-N-[4-(diethylamino)phenyl]acetamide.
| Compound Name | 2-(6-bromonaphthalen-2-yl)oxy-N-[4-(diethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 3872632 |
| Molecular Formula | C22H23BrN2O2 |
| Molecular Weight | 427.34 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 2-(6-bromonaphthalen-2-yl)oxy-N-[4-(diethylamino)phenyl]acetamide |
| SMILES | CCN(CC)c1ccc(NC(=O)COc2ccc3cc(Br)ccc3c2)cc1 |
| InChI | InChI=1S/C22H23BrN2O2/c1-3-25(4-2)20-10-8-19(9-11-20)24-22(26)15-27-21-12-6-16-13-18(23)7-5-17(16)14-21/h5-14H,3-4,15H2,1-2H3,(H,24,26) |
| InChIKey | BQGAUCOLDYYIDE-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.34 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|