C16H14N4OS — CID 38749928
2-phenylsulfanyl-N-(2-pyrazol-1-yl-3-pyridinyl)acetamide (PubChem CID 38749928) has the molecular formula C16H14N4OS and a molecular weight of 310.38 g/mol. Its IUPAC name is 2-phenylsulfanyl-N-(2-pyrazol-1-yl-3-pyridinyl)acetamide.
| Compound Name | 2-phenylsulfanyl-N-(2-pyrazol-1-yl-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 38749928 |
| Molecular Formula | C16H14N4OS |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 2-phenylsulfanyl-N-(2-pyrazol-1-yl-3-pyridinyl)acetamide |
| SMILES | O=C(CSc1ccccc1)Nc1cccnc1-n1cccn1 |
| InChI | InChI=1S/C16H14N4OS/c21-15(12-22-13-6-2-1-3-7-13)19-14-8-4-9-17-16(14)20-11-5-10-18-20/h1-11H,12H2,(H,19,21) |
| InChIKey | IAZIILFJXXXICS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |