C13H15N5O — CID 60842702
2-(cyclopropylamino)-N-(2-pyrazol-1-yl-3-pyridinyl)acetamide (PubChem CID 60842702) has the molecular formula C13H15N5O and a molecular weight of 257.30 g/mol. Its IUPAC name is 2-(cyclopropylamino)-N-(2-pyrazol-1-yl-3-pyridinyl)acetamide.
| Compound Name | 2-(cyclopropylamino)-N-(2-pyrazol-1-yl-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 60842702 |
| Molecular Formula | C13H15N5O |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 2-(cyclopropylamino)-N-(2-pyrazol-1-yl-3-pyridinyl)acetamide |
| SMILES | O=C(CNC1CC1)Nc1cccnc1-n1cccn1 |
| InChI | InChI=1S/C13H15N5O/c19-12(9-15-10-4-5-10)17-11-3-1-6-14-13(11)18-8-2-7-16-18/h1-3,6-8,10,15H,4-5,9H2,(H,17,19) |
| InChIKey | ZKYAZSIJGAFWNZ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |