C18H18N4O2S — CID 3876423
1-(2-oxocyclohexyl)sulfanyl-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 3876423) has the molecular formula C18H18N4O2S and a molecular weight of 354.44 g/mol. Its IUPAC name is 1-(2-oxocyclohexyl)sulfanyl-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 1-(2-oxocyclohexyl)sulfanyl-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 3876423 |
| Molecular Formula | C18H18N4O2S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 1-(2-oxocyclohexyl)sulfanyl-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | C=CCn1c(=O)c2ccccc2n2c(SC3CCCCC3=O)nnc12 |
| InChI | InChI=1S/C18H18N4O2S/c1-2-11-21-16(24)12-7-3-4-8-13(12)22-17(21)19-20-18(22)25-15-10-6-5-9-14(15)23/h2-4,7-8,15H,1,5-6,9-11H2 |
| InChIKey | ANXIJUPGBGYOPY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 69.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|