C24H20ClN3O3S2 — CID 38766050
2-(2-benzyl-1,3-thiazol-4-yl)-N-[3-[(2-chlorophenyl)sulfamoyl]phenyl]acetamide (PubChem CID 38766050) has the molecular formula C24H20ClN3O3S2 and a molecular weight of 498.03 g/mol. Its IUPAC name is 2-(2-benzyl-1,3-thiazol-4-yl)-N-[3-[(2-chlorophenyl)sulfamoyl]phenyl]acetamide.
| Compound Name | 2-(2-benzyl-1,3-thiazol-4-yl)-N-[3-[(2-chlorophenyl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 38766050 |
| Molecular Formula | C24H20ClN3O3S2 |
| Molecular Weight | 498.03 g/mol |
| Exact Mass | 497.06 |
| IUPAC Name | 2-(2-benzyl-1,3-thiazol-4-yl)-N-[3-[(2-chlorophenyl)sulfamoyl]phenyl]acetamide |
| SMILES | O=C(Cc1csc(Cc2ccccc2)n1)Nc1cccc(S(=O)(=O)Nc2ccccc2Cl)c1 |
| InChI | InChI=1S/C24H20ClN3O3S2/c25-21-11-4-5-12-22(21)28-33(30,31)20-10-6-9-18(14-20)26-23(29)15-19-16-32-24(27-19)13-17-7-2-1-3-8-17/h1-12,14,16,28H,13,15H2,(H,26,29) |
| InChIKey | PSQMICMOHOJZTH-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.03 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |