C26H23BrN2O4 — CID 3877997
4-[[5-bromo-2-[2-(3-methoxyphenoxy)ethoxy]phenyl]methylidene]-5-methyl-2-phenylpyrazol-3-one (PubChem CID 3877997) has the molecular formula C26H23BrN2O4 and a molecular weight of 507.38 g/mol. Its IUPAC name is 4-[[5-bromo-2-[2-(3-methoxyphenoxy)ethoxy]phenyl]methylidene]-5-methyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[[5-bromo-2-[2-(3-methoxyphenoxy)ethoxy]phenyl]methylidene]-5-methyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 3877997 |
| Molecular Formula | C26H23BrN2O4 |
| Molecular Weight | 507.38 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | 4-[[5-bromo-2-[2-(3-methoxyphenoxy)ethoxy]phenyl]methylidene]-5-methyl-2-phenylpyrazol-3-one |
| SMILES | COc1cccc(OCCOc2ccc(Br)cc2C=C2C(=O)N(c3ccccc3)N=C2C)c1 |
| InChI | InChI=1S/C26H23BrN2O4/c1-18-24(26(30)29(28-18)21-7-4-3-5-8-21)16-19-15-20(27)11-12-25(19)33-14-13-32-23-10-6-9-22(17-23)31-2/h3-12,15-17H,13-14H2,1-2H3 |
| InChIKey | RSMTWBPTJNSANT-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.38 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|