C23H20BrClN4O3S — CID 3878197
6-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2-ethyl-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 3878197) has the molecular formula C23H20BrClN4O3S and a molecular weight of 547.86 g/mol. Its IUPAC name is 6-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2-ethyl-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 6-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2-ethyl-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 3878197 |
| Molecular Formula | C23H20BrClN4O3S |
| Molecular Weight | 547.86 g/mol |
| Exact Mass | 546.01 |
| IUPAC Name | 6-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2-ethyl-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2cc(Br)c(OCc3ccccc3Cl)c(OCC)c2)C(=O)N=C2SC(CC)=NN21 |
| InChI | InChI=1S/C23H20BrClN4O3S/c1-3-19-28-29-21(26)15(22(30)27-23(29)33-19)9-13-10-16(24)20(18(11-13)31-4-2)32-12-14-7-5-6-8-17(14)25/h5-11,26H,3-4,12H2,1-2H3/b15-9?,26-21+ |
| InChIKey | BWRBJISAXPHCCK-GHVCMSRNSA-N |
| XLogP | 6.11 |
| TPSA | 87.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.86 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|