C27H27BrN4O4S — CID 4213914
6-[[3-bromo-5-ethoxy-4-[2-(2-prop-2-enylphenoxy)ethoxy]phenyl]methylidene]-2-ethyl-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 4213914) has the molecular formula C27H27BrN4O4S and a molecular weight of 583.51 g/mol. Its IUPAC name is 6-[[3-bromo-5-ethoxy-4-[2-(2-prop-2-enylphenoxy)ethoxy]phenyl]methylidene]-2-ethyl-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 6-[[3-bromo-5-ethoxy-4-[2-(2-prop-2-enylphenoxy)ethoxy]phenyl]methylidene]-2-ethyl-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 4213914 |
| Molecular Formula | C27H27BrN4O4S |
| Molecular Weight | 583.51 g/mol |
| Exact Mass | 582.09 |
| IUPAC Name | 6-[[3-bromo-5-ethoxy-4-[2-(2-prop-2-enylphenoxy)ethoxy]phenyl]methylidene]-2-ethyl-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2cc(Br)c(OCCOc3ccccc3CC=C)c(OCC)c2)C(=O)N=C2SC(CC)=NN21 |
| InChI | InChI=1S/C27H27BrN4O4S/c1-4-9-18-10-7-8-11-21(18)35-12-13-36-24-20(28)15-17(16-22(24)34-6-3)14-19-25(29)32-27(30-26(19)33)37-23(5-2)31-32/h4,7-8,10-11,14-16,29H,1,5-6,9,12-13H2,2-3H3/b19-14?,29-25+ |
| InChIKey | RBAKALFGVKZWRC-YVIBVFDVSA-N |
| XLogP | 6.06 |
| TPSA | 96.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.51 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|