C20H20N4O5S — CID 3878885
N-(6-ethoxy-1,3-benzothiazol-2-yl)-2-morpholin-4-yl-5-nitrobenzamide (PubChem CID 3878885) has the molecular formula C20H20N4O5S and a molecular weight of 428.47 g/mol. Its IUPAC name is N-(6-ethoxy-1,3-benzothiazol-2-yl)-2-morpholin-4-yl-5-nitrobenzamide.
| Compound Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-2-morpholin-4-yl-5-nitrobenzamide |
|---|---|
| PubChem CID | 3878885 |
| Molecular Formula | C20H20N4O5S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-2-morpholin-4-yl-5-nitrobenzamide |
| SMILES | CCOc1ccc2nc(NC(=O)c3cc([N+](=O)[O-])ccc3N3CCOCC3)sc2c1 |
| InChI | InChI=1S/C20H20N4O5S/c1-2-29-14-4-5-16-18(12-14)30-20(21-16)22-19(25)15-11-13(24(26)27)3-6-17(15)23-7-9-28-10-8-23/h3-6,11-12H,2,7-10H2,1H3,(H,21,22,25) |
| InChIKey | GRAYZGBSHBDAFN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 106.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|