C25H25ClN2O3S — CID 3879149
5-[benzyl(methyl)sulfamoyl]-2-chloro-N-(1,2,3,4-tetrahydronaphthalen-1-yl)benzamide (PubChem CID 3879149) has the molecular formula C25H25ClN2O3S and a molecular weight of 469.01 g/mol. Its IUPAC name is 5-[benzyl(methyl)sulfamoyl]-2-chloro-N-(1,2,3,4-tetrahydronaphthalen-1-yl)benzamide.
| Compound Name | 5-[benzyl(methyl)sulfamoyl]-2-chloro-N-(1,2,3,4-tetrahydronaphthalen-1-yl)benzamide |
|---|---|
| PubChem CID | 3879149 |
| Molecular Formula | C25H25ClN2O3S |
| Molecular Weight | 469.01 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 5-[benzyl(methyl)sulfamoyl]-2-chloro-N-(1,2,3,4-tetrahydronaphthalen-1-yl)benzamide |
| SMILES | CN(Cc1ccccc1)S(=O)(=O)c1ccc(Cl)c(C(=O)NC2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C25H25ClN2O3S/c1-28(17-18-8-3-2-4-9-18)32(30,31)20-14-15-23(26)22(16-20)25(29)27-24-13-7-11-19-10-5-6-12-21(19)24/h2-6,8-10,12,14-16,24H,7,11,13,17H2,1H3,(H,27,29) |
| InChIKey | DYKMBLYVXOPAOY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.01 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |