C27H28ClN3O4S — CID 16548325
5-[benzyl(methyl)sulfamoyl]-2-chloro-N-[2-(cyclopentylcarbamoyl)phenyl]benzamide (PubChem CID 16548325) has the molecular formula C27H28ClN3O4S and a molecular weight of 526.06 g/mol. Its IUPAC name is 5-[benzyl(methyl)sulfamoyl]-2-chloro-N-[2-(cyclopentylcarbamoyl)phenyl]benzamide.
| Compound Name | 5-[benzyl(methyl)sulfamoyl]-2-chloro-N-[2-(cyclopentylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 16548325 |
| Molecular Formula | C27H28ClN3O4S |
| Molecular Weight | 526.06 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | 5-[benzyl(methyl)sulfamoyl]-2-chloro-N-[2-(cyclopentylcarbamoyl)phenyl]benzamide |
| SMILES | CN(Cc1ccccc1)S(=O)(=O)c1ccc(Cl)c(C(=O)Nc2ccccc2C(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C27H28ClN3O4S/c1-31(18-19-9-3-2-4-10-19)36(34,35)21-15-16-24(28)23(17-21)27(33)30-25-14-8-7-13-22(25)26(32)29-20-11-5-6-12-20/h2-4,7-10,13-17,20H,5-6,11-12,18H2,1H3,(H,29,32)(H,30,33) |
| InChIKey | FPUQVJFNGXFICM-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.06 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |