C10H20N2O4 — CID 3881285
N-(2-acetamido-1,2-diethoxyethyl)acetamide (PubChem CID 3881285) has the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. Its IUPAC name is N-(2-acetamido-1,2-diethoxyethyl)acetamide.
| Compound Name | N-(2-acetamido-1,2-diethoxyethyl)acetamide |
|---|---|
| PubChem CID | 3881285 |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | N-(2-acetamido-1,2-diethoxyethyl)acetamide |
| SMILES | CCOC(NC(C)=O)C(NC(C)=O)OCC |
| InChI | InChI=1S/C10H20N2O4/c1-5-15-9(11-7(3)13)10(16-6-2)12-8(4)14/h9-10H,5-6H2,1-4H3,(H,11,13)(H,12,14) |
| InChIKey | LFSMXZXYRIGJID-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|