C12H9F3N4O — CID 3885378
2-methyl-5-oxo-4-(pyridin-2-ylamino)-4-(trifluoromethyl)-1H-pyrrole-3-carbonitrile (PubChem CID 3885378) has the molecular formula C12H9F3N4O and a molecular weight of 282.22 g/mol. Its IUPAC name is 2-methyl-5-oxo-4-(pyridin-2-ylamino)-4-(trifluoromethyl)-1H-pyrrole-3-carbonitrile.
| Compound Name | 2-methyl-5-oxo-4-(pyridin-2-ylamino)-4-(trifluoromethyl)-1H-pyrrole-3-carbonitrile |
|---|---|
| PubChem CID | 3885378 |
| Molecular Formula | C12H9F3N4O |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 2-methyl-5-oxo-4-(pyridin-2-ylamino)-4-(trifluoromethyl)-1H-pyrrole-3-carbonitrile |
| SMILES | CC1=C(C#N)C(Nc2ccccn2)(C(F)(F)F)C(=O)N1 |
| InChI | InChI=1S/C12H9F3N4O/c1-7-8(6-16)11(10(20)18-7,12(13,14)15)19-9-4-2-3-5-17-9/h2-5H,1H3,(H,17,19)(H,18,20) |
| InChIKey | PFFPSHGDFKSAKG-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |