C18H27N5O4 — CID 38883974
4-[2-(diethylamino)-2-oxoethyl]-N-(2-nitrophenyl)-1,4-diazepane-1-carboxamide (PubChem CID 38883974) has the molecular formula C18H27N5O4 and a molecular weight of 377.45 g/mol. Its IUPAC name is 4-[2-(diethylamino)-2-oxoethyl]-N-(2-nitrophenyl)-1,4-diazepane-1-carboxamide.
| Compound Name | 4-[2-(diethylamino)-2-oxoethyl]-N-(2-nitrophenyl)-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 38883974 |
| Molecular Formula | C18H27N5O4 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 4-[2-(diethylamino)-2-oxoethyl]-N-(2-nitrophenyl)-1,4-diazepane-1-carboxamide |
| SMILES | CCN(CC)C(=O)CN1CCCN(C(=O)Nc2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C18H27N5O4/c1-3-21(4-2)17(24)14-20-10-7-11-22(13-12-20)18(25)19-15-8-5-6-9-16(15)23(26)27/h5-6,8-9H,3-4,7,10-14H2,1-2H3,(H,19,25) |
| InChIKey | JSAKMXZXNQEWCW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|