C27H47N2+ — CID 3888461
5,6-dimethyl-1,3-di(nonyl)benzimidazol-3-ium (PubChem CID 3888461) has the molecular formula C27H47N2+ and a molecular weight of 399.69 g/mol. Its IUPAC name is 5,6-dimethyl-1,3-di(nonyl)benzimidazol-3-ium.
| Compound Name | 5,6-dimethyl-1,3-di(nonyl)benzimidazol-3-ium |
|---|---|
| PubChem CID | 3888461 |
| Molecular Formula | C27H47N2+ |
| Molecular Weight | 399.69 g/mol |
| Exact Mass | 399.37 |
| IUPAC Name | 5,6-dimethyl-1,3-di(nonyl)benzimidazol-3-ium |
| SMILES | CCCCCCCCCn1c[n+](CCCCCCCCC)c2cc(C)c(C)cc21 |
| InChI | InChI=1S/C27H47N2/c1-5-7-9-11-13-15-17-19-28-23-29(20-18-16-14-12-10-8-6-2)27-22-25(4)24(3)21-26(27)28/h21-23H,5-20H2,1-4H3/q+1 |
| InChIKey | ZESNZUUIAKKVKA-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.69 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|