C25H43F6N2P — CID 139045132
1,3-di(nonyl)benzimidazol-3-ium hexafluorophosphate (PubChem CID 139045132) has the molecular formula C25H43F6N2P and a molecular weight of 516.60 g/mol. Its IUPAC name is 1,3-di(nonyl)benzimidazol-3-ium hexafluorophosphate.
| Compound Name | 1,3-di(nonyl)benzimidazol-3-ium hexafluorophosphate |
|---|---|
| PubChem CID | 139045132 |
| Molecular Formula | C25H43F6N2P |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | 1,3-di(nonyl)benzimidazol-3-ium hexafluorophosphate |
| SMILES | CCCCCCCCCn1c[n+](CCCCCCCCC)c2ccccc21.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C25H43N2.F6P/c1-3-5-7-9-11-13-17-21-26-23-27(25-20-16-15-19-24(25)26)22-18-14-12-10-8-6-4-2;1-7(2,3,4,5)6/h15-16,19-20,23H,3-14,17-18,21-22H2,1-2H3;/q+1;-1 |
| InChIKey | BLLFHHJNJWZRAX-UHFFFAOYSA-N |
| XLogP | 10.81 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|