C15H23BrN2O — CID 89439356
6-(3-ethylbenzimidazol-1-ium-1-yl)hexan-1-ol bromide (PubChem CID 89439356) has the molecular formula C15H23BrN2O and a molecular weight of 327.27 g/mol. Its IUPAC name is 6-(3-ethylbenzimidazol-1-ium-1-yl)hexan-1-ol bromide.
| Compound Name | 6-(3-ethylbenzimidazol-1-ium-1-yl)hexan-1-ol bromide |
|---|---|
| PubChem CID | 89439356 |
| Molecular Formula | C15H23BrN2O |
| Molecular Weight | 327.27 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 6-(3-ethylbenzimidazol-1-ium-1-yl)hexan-1-ol bromide |
| SMILES | CCn1c[n+](CCCCCCO)c2ccccc21.[Br-] |
| InChI | InChI=1S/C15H23N2O.BrH/c1-2-16-13-17(11-7-3-4-8-12-18)15-10-6-5-9-14(15)16;/h5-6,9-10,13,18H,2-4,7-8,11-12H2,1H3;1H/q+1;/p-1 |
| InChIKey | YDHOWTVSGJGEKZ-UHFFFAOYSA-M |
| XLogP | -0.49 |
| TPSA | 29.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.27 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|