C15H25N2Si+ — CID 10450042
3-(3-ethylbenzimidazol-1-ium-1-yl)propyl-trimethylsilane (PubChem CID 10450042) has the molecular formula C15H25N2Si+ and a molecular weight of 261.46 g/mol. Its IUPAC name is 3-(3-ethylbenzimidazol-1-ium-1-yl)propyl-trimethylsilane.
| Compound Name | 3-(3-ethylbenzimidazol-1-ium-1-yl)propyl-trimethylsilane |
|---|---|
| PubChem CID | 10450042 |
| Molecular Formula | C15H25N2Si+ |
| Molecular Weight | 261.46 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | 3-(3-ethylbenzimidazol-1-ium-1-yl)propyl-trimethylsilane |
| SMILES | CCn1c[n+](CCC[Si](C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C15H25N2Si/c1-5-16-13-17(11-8-12-18(2,3)4)15-10-7-6-9-14(15)16/h6-7,9-10,13H,5,8,11-12H2,1-4H3/q+1 |
| InChIKey | FKTDBTBEUKYYEF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|