C11H14N3O+ — CID 102113083
2-(3-ethylbenzimidazol-1-ium-1-yl)acetamide (PubChem CID 102113083) has the molecular formula C11H14N3O+ and a molecular weight of 204.25 g/mol. Its IUPAC name is 2-(3-ethylbenzimidazol-1-ium-1-yl)acetamide.
| Compound Name | 2-(3-ethylbenzimidazol-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 102113083 |
| Molecular Formula | C11H14N3O+ |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 2-(3-ethylbenzimidazol-1-ium-1-yl)acetamide |
| SMILES | CCn1c[n+](CC(N)=O)c2ccccc21 |
| InChI | InChI=1S/C11H13N3O/c1-2-13-8-14(7-11(12)15)10-6-4-3-5-9(10)13/h3-6,8H,2,7H2,1H3,(H-,12,15)/p+1 |
| InChIKey | UPAAMUXPOKLPOM-UHFFFAOYSA-O |
| XLogP | 0.43 |
| TPSA | 51.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|