C25H25N7O4S — CID 3891166
[2-[[5-methyl-4-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3-oxazol-4-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 3891166) has the molecular formula C25H25N7O4S and a molecular weight of 519.59 g/mol. Its IUPAC name is [2-[[5-methyl-4-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3-oxazol-4-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | [2-[[5-methyl-4-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3-oxazol-4-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 3891166 |
| Molecular Formula | C25H25N7O4S |
| Molecular Weight | 519.59 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | [2-[[5-methyl-4-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3-oxazol-4-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | Cc1cccc(-n2c(C)nnc2SCc2nc(C(=O)N3CCN(c4ccc([N+](=O)[O-])cc4)CC3)co2)c1 |
| InChI | InChI=1S/C25H25N7O4S/c1-17-4-3-5-21(14-17)31-18(2)27-28-25(31)37-16-23-26-22(15-36-23)24(33)30-12-10-29(11-13-30)19-6-8-20(9-7-19)32(34)35/h3-9,14-15H,10-13,16H2,1-2H3 |
| InChIKey | CDIKAQHIGIXCQC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 123.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.59 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|